C16H25NOS — CID 107758741
N-methyl-2-pentylsulfinyl-1,2,3,4-tetrahydronaphthalen-1-amine (PubChem CID 107758741) has the molecular formula C16H25NOS and a molecular weight of 279.45 g/mol. Its IUPAC name is N-methyl-2-pentylsulfinyl-1,2,3,4-tetrahydronaphthalen-1-amine.
| Compound Name | N-methyl-2-pentylsulfinyl-1,2,3,4-tetrahydronaphthalen-1-amine |
|---|---|
| PubChem CID | 107758741 |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.45 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-methyl-2-pentylsulfinyl-1,2,3,4-tetrahydronaphthalen-1-amine |
| SMILES | CCCCCS(=O)C1CCc2ccccc2C1NC |
| InChI | InChI=1S/C16H25NOS/c1-3-4-7-12-19(18)15-11-10-13-8-5-6-9-14(13)16(15)17-2/h5-6,8-9,15-17H,3-4,7,10-12H2,1-2H3 |
| InChIKey | SIVRZRPNWJMAIW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.45 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|