About 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol
2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol (PubChem CID 10775929) has the molecular formula C11H8N2O2S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol.
Molecular Properties
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol |
| PubChem CID | 10775929 |
| Molecular Formula | C11H8N2O2S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol |
| SMILES | Oc1ccc(O)c(-c2cn3ccsc3n2)c1 |
| InChI | InChI=1S/C11H8N2O2S/c14-7-1-2-10(15)8(5-7)9-6-13-3-4-16-11(13)12-9/h1-6,14-15H |
| InChIKey | RNSZNZFGNZQNSJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 57.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol?
The IUPAC name of 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol (CID 10775929) is 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol.
What is the SMILES notation for 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol?
The canonical SMILES for 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol is Oc1ccc(O)c(-c2cn3ccsc3n2)c1.
What is the InChIKey of 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol?
The InChIKey is RNSZNZFGNZQNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8N2O2S/c14-7-1-2-10(15)8(5-7)9-6-13-3-4-16-11(13)12-9/h1-6,14-15H.
What are the key properties of 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol?
2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol has a molecular weight of 232.26 g/mol, XLogP of 2.47, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[2,1-b][1,3]thiazol-6-ylbenzene-1,4-diol is sourced from PubChem (CID 10775929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).