C13H15NO3 — CID 10775989
3-(2-methyl-3-phenylpropanoyl)-1,3-oxazolidin-2-one (PubChem CID 10775989) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is 3-(2-methyl-3-phenylpropanoyl)-1,3-oxazolidin-2-one.
| Compound Name | 3-(2-methyl-3-phenylpropanoyl)-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 10775989 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 3-(2-methyl-3-phenylpropanoyl)-1,3-oxazolidin-2-one |
| SMILES | CC(Cc1ccccc1)C(=O)N1CCOC1=O |
| InChI | InChI=1S/C13H15NO3/c1-10(9-11-5-3-2-4-6-11)12(15)14-7-8-17-13(14)16/h2-6,10H,7-9H2,1H3 |
| InChIKey | RTTHFKGBXJSZOK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |