C11H13N3O3 — CID 10776108
methyl (5S,9aR)-7-oxo-3,4,5,8,9,9a-hexahydroimidazo[4,5-g]indolizine-5-carboxylate (PubChem CID 10776108) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is methyl (5S,9aR)-7-oxo-3,4,5,8,9,9a-hexahydroimidazo[4,5-g]indolizine-5-carboxylate.
| Compound Name | methyl (5S,9aR)-7-oxo-3,4,5,8,9,9a-hexahydroimidazo[4,5-g]indolizine-5-carboxylate |
|---|---|
| PubChem CID | 10776108 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | methyl (5S,9aR)-7-oxo-3,4,5,8,9,9a-hexahydroimidazo[4,5-g]indolizine-5-carboxylate |
| SMILES | COC(=O)[C@@H]1Cc2[nH]cnc2[C@H]2CCC(=O)N21 |
| InChI | InChI=1S/C11H13N3O3/c1-17-11(16)8-4-6-10(13-5-12-6)7-2-3-9(15)14(7)8/h5,7-8H,2-4H2,1H3,(H,12,13)/t7-,8+/m1/s1 |
| InChIKey | BGHOCVMLXMAGHQ-SFYZADRCSA-N |
| XLogP | 0.17 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |