C14H22NO2+ — CID 10776138
1,1-dipropyl-2,3-dihydroindol-1-ium-5,6-diol (PubChem CID 10776138) has the molecular formula C14H22NO2+ and a molecular weight of 236.33 g/mol. Its IUPAC name is 1,1-dipropyl-2,3-dihydroindol-1-ium-5,6-diol.
| Compound Name | 1,1-dipropyl-2,3-dihydroindol-1-ium-5,6-diol |
|---|---|
| PubChem CID | 10776138 |
| Molecular Formula | C14H22NO2+ |
| Molecular Weight | 236.33 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,1-dipropyl-2,3-dihydroindol-1-ium-5,6-diol |
| SMILES | CCC[N+]1(CCC)CCc2cc(O)c(O)cc21 |
| InChI | InChI=1S/C14H21NO2/c1-3-6-15(7-4-2)8-5-11-9-13(16)14(17)10-12(11)15/h9-10H,3-8H2,1-2H3,(H-,16,17)/p+1 |
| InChIKey | TXVOVJSCUBMVRV-UHFFFAOYSA-O |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|