C13H20O2Si — CID 10776226
1-(4-trimethylsilyl-1,3,5,6-tetrahydro-2-benzofuran-5-yl)ethanone (PubChem CID 10776226) has the molecular formula C13H20O2Si and a molecular weight of 236.39 g/mol. Its IUPAC name is 1-(4-trimethylsilyl-1,3,5,6-tetrahydro-2-benzofuran-5-yl)ethanone.
| Compound Name | 1-(4-trimethylsilyl-1,3,5,6-tetrahydro-2-benzofuran-5-yl)ethanone |
|---|---|
| PubChem CID | 10776226 |
| Molecular Formula | C13H20O2Si |
| Molecular Weight | 236.39 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 1-(4-trimethylsilyl-1,3,5,6-tetrahydro-2-benzofuran-5-yl)ethanone |
| SMILES | CC(=O)C1CC=C2COCC2=C1[Si](C)(C)C |
| InChI | InChI=1S/C13H20O2Si/c1-9(14)11-6-5-10-7-15-8-12(10)13(11)16(2,3)4/h5,11H,6-8H2,1-4H3 |
| InChIKey | MNLSMAKZLHBEKX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|