C12H15NO4 — CID 10776247
[1-(4-methoxyphenyl)-2-(methylamino)-2-oxoethyl] acetate (PubChem CID 10776247) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is [1-(4-methoxyphenyl)-2-(methylamino)-2-oxoethyl] acetate.
| Compound Name | [1-(4-methoxyphenyl)-2-(methylamino)-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 10776247 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | [1-(4-methoxyphenyl)-2-(methylamino)-2-oxoethyl] acetate |
| SMILES | CNC(=O)C(OC(C)=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C12H15NO4/c1-8(14)17-11(12(15)13-2)9-4-6-10(16-3)7-5-9/h4-7,11H,1-3H3,(H,13,15) |
| InChIKey | OCFIIGXOPWVIBE-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |