C16H14O2 — CID 10776304
2-[(E)-2-(3,4-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione (PubChem CID 10776304) has the molecular formula C16H14O2 and a molecular weight of 238.29 g/mol. Its IUPAC name is 2-[(E)-2-(3,4-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione.
| Compound Name | 2-[(E)-2-(3,4-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione |
|---|---|
| PubChem CID | 10776304 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 2-[(E)-2-(3,4-dimethylphenyl)ethenyl]cyclohexa-2,5-diene-1,4-dione |
| SMILES | Cc1ccc(/C=C/C2=CC(=O)C=CC2=O)cc1C |
| InChI | InChI=1S/C16H14O2/c1-11-3-4-13(9-12(11)2)5-6-14-10-15(17)7-8-16(14)18/h3-10H,1-2H3/b6-5+ |
| InChIKey | WWTLRZBNQFREPV-AATRIKPKSA-N |
| XLogP | 2.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|