C18H31NS — CID 107763388
N-ethyl-2-(3-methylbutan-2-ylsulfanyl)-1-(4-propylphenyl)ethanamine (PubChem CID 107763388) has the molecular formula C18H31NS and a molecular weight of 293.52 g/mol. Its IUPAC name is N-ethyl-2-(3-methylbutan-2-ylsulfanyl)-1-(4-propylphenyl)ethanamine.
| Compound Name | N-ethyl-2-(3-methylbutan-2-ylsulfanyl)-1-(4-propylphenyl)ethanamine |
|---|---|
| PubChem CID | 107763388 |
| Molecular Formula | C18H31NS |
| Molecular Weight | 293.52 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | N-ethyl-2-(3-methylbutan-2-ylsulfanyl)-1-(4-propylphenyl)ethanamine |
| SMILES | CCCc1ccc(C(CSC(C)C(C)C)NCC)cc1 |
| InChI | InChI=1S/C18H31NS/c1-6-8-16-9-11-17(12-10-16)18(19-7-2)13-20-15(5)14(3)4/h9-12,14-15,18-19H,6-8,13H2,1-5H3 |
| InChIKey | LDNPAXYPLPDDMH-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.52 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |