About cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone
cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone (PubChem CID 10776453) has the molecular formula C13H24O2Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone |
| PubChem CID | 10776453 |
| Molecular Formula | C13H24O2Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone |
| SMILES | C[Si](C)(O)[C@@H]1CC[C@@H](C(=O)C2CCCC2)C1 |
| InChI | InChI=1S/C13H24O2Si/c1-16(2,15)12-8-7-11(9-12)13(14)10-5-3-4-6-10/h10-12,15H,3-9H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | JSVKXCNIENKVIK-VXGBXAGGSA-N |
| XLogP | 3.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone?
The IUPAC name of cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone (CID 10776453) is cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone.
What is the SMILES notation for cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone?
The canonical SMILES for cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone is C[Si](C)(O)[C@@H]1CC[C@@H](C(=O)C2CCCC2)C1.
What is the InChIKey of cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone?
The InChIKey is JSVKXCNIENKVIK-VXGBXAGGSA-N. The full InChI is InChI=1S/C13H24O2Si/c1-16(2,15)12-8-7-11(9-12)13(14)10-5-3-4-6-10/h10-12,15H,3-9H2,1-2H3/t11-,12-/m1/s1.
What are the key properties of cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone?
cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone has a molecular weight of 240.42 g/mol, XLogP of 3.11, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[(1R,3R)-3-[hydroxy(dimethyl)silyl]cyclopentyl]methanone is sourced from PubChem (CID 10776453), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).