C10H11BrFN — CID 10776652
(S)-7-Bromo-3-fluoromethyl-1,2,3,4-tetrahydro-isoquinoline (PubChem CID 10776652) has the molecular formula C10H11BrFN and a molecular weight of 244.10 g/mol. Its IUPAC name is (3S)-7-bromo-3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | (S)-7-Bromo-3-fluoromethyl-1,2,3,4-tetrahydro-isoquinoline |
|---|---|
| PubChem CID | 10776652 |
| Molecular Formula | C10H11BrFN |
| Molecular Weight | 244.10 g/mol |
| Exact Mass | 243.01 |
| IUPAC Name | (3S)-7-bromo-3-(fluoromethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | C1[C@H](NCC2=C1C=CC(=C2)Br)CF |
| InChI | InChI=1S/C10H11BrFN/c11-9-2-1-7-4-10(5-12)13-6-8(7)3-9/h1-3,10,13H,4-6H2/t10-/m0/s1 |
| InChIKey | KJOCLAIPXOCSLQ-JTQLQIEISA-N |
| XLogP | 2.40 |
| TPSA | 12.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | 176 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.10 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |