C15H20N2O3S — CID 107766914
N-(3-cyanophenyl)-2-(3-methylbutan-2-ylsulfonyl)propanamide (PubChem CID 107766914) has the molecular formula C15H20N2O3S and a molecular weight of 308.40 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(3-methylbutan-2-ylsulfonyl)propanamide.
| Compound Name | N-(3-cyanophenyl)-2-(3-methylbutan-2-ylsulfonyl)propanamide |
|---|---|
| PubChem CID | 107766914 |
| Molecular Formula | C15H20N2O3S |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.12 |
| IUPAC Name | N-(3-cyanophenyl)-2-(3-methylbutan-2-ylsulfonyl)propanamide |
| SMILES | CC(C)C(C)S(=O)(=O)C(C)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C15H20N2O3S/c1-10(2)11(3)21(19,20)12(4)15(18)17-14-7-5-6-13(8-14)9-16/h5-8,10-12H,1-4H3,(H,17,18) |
| InChIKey | HVANVBUDTVJBEM-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |