C17H24O — CID 10776713
(6S,7E,9E)-heptadeca-7,9-dien-11,13-diyn-6-ol (PubChem CID 10776713) has the molecular formula C17H24O and a molecular weight of 244.38 g/mol. Its IUPAC name is (6S,7E,9E)-heptadeca-7,9-dien-11,13-diyn-6-ol.
| Compound Name | (6S,7E,9E)-heptadeca-7,9-dien-11,13-diyn-6-ol |
|---|---|
| PubChem CID | 10776713 |
| Molecular Formula | C17H24O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.18 |
| IUPAC Name | (6S,7E,9E)-heptadeca-7,9-dien-11,13-diyn-6-ol |
| SMILES | CCCC#CC#C/C=C/C=C/[C@@H](O)CCCCC |
| InChI | InChI=1S/C17H24O/c1-3-5-7-8-9-10-11-12-14-16-17(18)15-13-6-4-2/h11-12,14,16-18H,3-6,13,15H2,1-2H3/b12-11+,16-14+/t17-/m0/s1 |
| InChIKey | FWOOMNCMIMPWFM-ZGRLATHUSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|