C12H15N5O — CID 10776761
(1S,11R)-11,14,14-trimethyl-3,4,6,7,9-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,7,9-trien-5-one (PubChem CID 10776761) has the molecular formula C12H15N5O and a molecular weight of 245.29 g/mol. Its IUPAC name is (1S,11R)-11,14,14-trimethyl-3,4,6,7,9-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,7,9-trien-5-one.
| Compound Name | (1S,11R)-11,14,14-trimethyl-3,4,6,7,9-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,7,9-trien-5-one |
|---|---|
| PubChem CID | 10776761 |
| Molecular Formula | C12H15N5O |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.13 |
| IUPAC Name | (1S,11R)-11,14,14-trimethyl-3,4,6,7,9-pentazatetracyclo[9.2.1.02,10.04,8]tetradeca-2,7,9-trien-5-one |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)c1nc3n[nH]c(=O)n3nc12 |
| InChI | InChI=1S/C12H15N5O/c1-11(2)6-4-5-12(11,3)8-7(6)16-17-9(13-8)14-15-10(17)18/h6H,4-5H2,1-3H3,(H,15,18)/t6-,12+/m1/s1 |
| InChIKey | LDOMIIBRKXCXRN-INWYIAFRSA-N |
| XLogP | 0.99 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |