C9H11N3O4S — CID 107768331
2-acetamido-3-[(6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid (PubChem CID 107768331) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 2-acetamido-3-[(6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid.
| Compound Name | 2-acetamido-3-[(6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid |
|---|---|
| PubChem CID | 107768331 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 2-acetamido-3-[(6-oxo-1H-pyrimidin-4-yl)sulfanyl]propanoic acid |
| SMILES | CC(=O)NC(CSc1cc(=O)[nH]cn1)C(=O)O |
| InChI | InChI=1S/C9H11N3O4S/c1-5(13)12-6(9(15)16)3-17-8-2-7(14)10-4-11-8/h2,4,6H,3H2,1H3,(H,12,13)(H,15,16)(H,10,11,14) |
| InChIKey | MYPZAZYOFFVWLV-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |