C12H13ClFNO4S — CID 107768743
2-acetamido-3-[(5-chloro-2-fluorophenyl)methylsulfinyl]propanoic acid (PubChem CID 107768743) has the molecular formula C12H13ClFNO4S and a molecular weight of 321.76 g/mol. Its IUPAC name is 2-acetamido-3-[(5-chloro-2-fluorophenyl)methylsulfinyl]propanoic acid.
| Compound Name | 2-acetamido-3-[(5-chloro-2-fluorophenyl)methylsulfinyl]propanoic acid |
|---|---|
| PubChem CID | 107768743 |
| Molecular Formula | C12H13ClFNO4S |
| Molecular Weight | 321.76 g/mol |
| Exact Mass | 321.02 |
| IUPAC Name | 2-acetamido-3-[(5-chloro-2-fluorophenyl)methylsulfinyl]propanoic acid |
| SMILES | CC(=O)NC(CS(=O)Cc1cc(Cl)ccc1F)C(=O)O |
| InChI | InChI=1S/C12H13ClFNO4S/c1-7(16)15-11(12(17)18)6-20(19)5-8-4-9(13)2-3-10(8)14/h2-4,11H,5-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | MXJPODPHCQUYDX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.76 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |