About 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one
7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one (PubChem CID 10776936) has the molecular formula C16H12N2O
and a molecular weight of 248.29 g/mol. Its IUPAC name is 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one.
Molecular Properties
| Compound Name | 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one |
| PubChem CID | 10776936 |
| Molecular Formula | C16H12N2O |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.09 |
| IUPAC Name | 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one |
| SMILES | Cc1ccc2[nH]c3c(=O)c4ccccc4[nH]c3c2c1 |
| InChI | InChI=1S/C16H12N2O/c1-9-6-7-13-11(8-9)14-15(18-13)16(19)10-4-2-3-5-12(10)17-14/h2-8,18H,1H3,(H,17,19) |
| InChIKey | XGPXQPZRRREVHS-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one?
The IUPAC name of 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one (CID 10776936) is 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one.
What is the SMILES notation for 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one?
The canonical SMILES for 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one is Cc1ccc2[nH]c3c(=O)c4ccccc4[nH]c3c2c1.
What is the InChIKey of 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one?
The InChIKey is XGPXQPZRRREVHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O/c1-9-6-7-13-11(8-9)14-15(18-13)16(19)10-4-2-3-5-12(10)17-14/h2-8,18H,1H3,(H,17,19).
What are the key properties of 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one?
7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one has a molecular weight of 248.29 g/mol, XLogP of 3.47, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,10-dihydroindolo[3,2-b]quinolin-11-one is sourced from PubChem (CID 10776936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).