C10H13Cl2NOS — CID 107770294
3-(2-amino-4,5-dichlorophenyl)sulfanylbutan-2-ol (PubChem CID 107770294) has the molecular formula C10H13Cl2NOS and a molecular weight of 266.19 g/mol. Its IUPAC name is 3-(2-amino-4,5-dichlorophenyl)sulfanylbutan-2-ol.
| Compound Name | 3-(2-amino-4,5-dichlorophenyl)sulfanylbutan-2-ol |
|---|---|
| PubChem CID | 107770294 |
| Molecular Formula | C10H13Cl2NOS |
| Molecular Weight | 266.19 g/mol |
| Exact Mass | 265.01 |
| IUPAC Name | 3-(2-amino-4,5-dichlorophenyl)sulfanylbutan-2-ol |
| SMILES | CC(O)C(C)Sc1cc(Cl)c(Cl)cc1N |
| InChI | InChI=1S/C10H13Cl2NOS/c1-5(14)6(2)15-10-4-8(12)7(11)3-9(10)13/h3-6,14H,13H2,1-2H3 |
| InChIKey | YNVNVBIJNFSKNT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.19 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|