About 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol
3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol (PubChem CID 107771016) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol.
Molecular Properties
| Compound Name | 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol |
| PubChem CID | 107771016 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol |
| SMILES | CC(O)C(C)Sc1nccn2nccc12 |
| InChI | InChI=1S/C10H13N3OS/c1-7(14)8(2)15-10-9-3-4-12-13(9)6-5-11-10/h3-8,14H,1-2H3 |
| InChIKey | GKOFVLAKULBHQB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol?
The IUPAC name of 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol (CID 107771016) is 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol.
What is the SMILES notation for 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol?
The canonical SMILES for 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol is CC(O)C(C)Sc1nccn2nccc12.
What is the InChIKey of 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol?
The InChIKey is GKOFVLAKULBHQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS/c1-7(14)8(2)15-10-9-3-4-12-13(9)6-5-11-10/h3-8,14H,1-2H3.
What are the key properties of 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol?
3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol has a molecular weight of 223.30 g/mol, XLogP of 1.59, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pyrazolo[1,5-a]pyrazin-4-ylsulfanylbutan-2-ol is sourced from PubChem (CID 107771016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).