C10H19NO3S — CID 107771721
1-amino-3-(3-hydroxybutan-2-ylsulfanyl)cyclopentane-1-carboxylic acid (PubChem CID 107771721) has the molecular formula C10H19NO3S and a molecular weight of 233.33 g/mol. Its IUPAC name is 1-amino-3-(3-hydroxybutan-2-ylsulfanyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-amino-3-(3-hydroxybutan-2-ylsulfanyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 107771721 |
| Molecular Formula | C10H19NO3S |
| Molecular Weight | 233.33 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 1-amino-3-(3-hydroxybutan-2-ylsulfanyl)cyclopentane-1-carboxylic acid |
| SMILES | CC(O)C(C)SC1CCC(N)(C(=O)O)C1 |
| InChI | InChI=1S/C10H19NO3S/c1-6(12)7(2)15-8-3-4-10(11,5-8)9(13)14/h6-8,12H,3-5,11H2,1-2H3,(H,13,14) |
| InChIKey | BFOKRBTWUKHNOZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.33 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |