About 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol
3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol (PubChem CID 107772462) has the molecular formula C17H29NOS
and a molecular weight of 295.49 g/mol. Its IUPAC name is 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol.
Molecular Properties
| Compound Name | 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol |
| PubChem CID | 107772462 |
| Molecular Formula | C17H29NOS |
| Molecular Weight | 295.49 g/mol |
| Exact Mass | 295.20 |
| IUPAC Name | 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol |
| SMILES | CCNC(CSC(C)C(C)O)c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C17H29NOS/c1-7-18-16(10-20-15(6)14(5)19)17-12(3)8-11(2)9-13(17)4/h8-9,14-16,18-19H,7,10H2,1-6H3 |
| InChIKey | FZTJBDIHUYVKEA-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.49 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol?
The IUPAC name of 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol (CID 107772462) is 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol.
What is the SMILES notation for 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol?
The canonical SMILES for 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol is CCNC(CSC(C)C(C)O)c1c(C)cc(C)cc1C.
What is the InChIKey of 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol?
The InChIKey is FZTJBDIHUYVKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NOS/c1-7-18-16(10-20-15(6)14(5)19)17-12(3)8-11(2)9-13(17)4/h8-9,14-16,18-19H,7,10H2,1-6H3.
What are the key properties of 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol?
3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol has a molecular weight of 295.49 g/mol, XLogP of 3.76, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(ethylamino)-2-(2,4,6-trimethylphenyl)ethyl]sulfanylbutan-2-ol is sourced from PubChem (CID 107772462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).