C15H27NO2 — CID 10777283
1-[(2S,6R)-2-[(2R)-2-hydroxypentyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]butan-2-one (PubChem CID 10777283) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 1-[(2S,6R)-2-[(2R)-2-hydroxypentyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]butan-2-one.
| Compound Name | 1-[(2S,6R)-2-[(2R)-2-hydroxypentyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]butan-2-one |
|---|---|
| PubChem CID | 10777283 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 1-[(2S,6R)-2-[(2R)-2-hydroxypentyl]-1-methyl-3,6-dihydro-2H-pyridin-6-yl]butan-2-one |
| SMILES | CCC[C@@H](O)C[C@@H]1CC=C[C@@H](CC(=O)CC)N1C |
| InChI | InChI=1S/C15H27NO2/c1-4-7-15(18)11-13-9-6-8-12(16(13)3)10-14(17)5-2/h6,8,12-13,15,18H,4-5,7,9-11H2,1-3H3/t12-,13-,15+/m0/s1 |
| InChIKey | YXZGFTYVZJDUDK-KCQAQPDRSA-N |
| XLogP | 2.54 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|