C8H8N2O5S — CID 107773985
(4S)-2-(5-nitrofuran-2-yl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 107773985) has the molecular formula C8H8N2O5S and a molecular weight of 244.23 g/mol. Its IUPAC name is (4S)-2-(5-nitrofuran-2-yl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-2-(5-nitrofuran-2-yl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 107773985 |
| Molecular Formula | C8H8N2O5S |
| Molecular Weight | 244.23 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | (4S)-2-(5-nitrofuran-2-yl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@H]1CSC(c2ccc([N+](=O)[O-])o2)N1 |
| InChI | InChI=1S/C8H8N2O5S/c11-8(12)4-3-16-7(9-4)5-1-2-6(15-5)10(13)14/h1-2,4,7,9H,3H2,(H,11,12)/t4-,7?/m1/s1 |
| InChIKey | OKAVQTFDTAVAAP-AWGJQOPUSA-N |
| XLogP | 0.98 |
| TPSA | 105.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|