About 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one
1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one (PubChem CID 10777410) has the molecular formula C17H21NO
and a molecular weight of 255.36 g/mol. Its IUPAC name is 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one |
| PubChem CID | 10777410 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one |
| SMILES | O=C1CCC=C(c2ccccc2)N1C1CCCCC1 |
| InChI | InChI=1S/C17H21NO/c19-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15/h1,3-4,8-9,12,15H,2,5-7,10-11,13H2 |
| InChIKey | BDDPHDDROFKLDM-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one?
The IUPAC name of 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one (CID 10777410) is 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one.
What is the SMILES notation for 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one?
The canonical SMILES for 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one is O=C1CCC=C(c2ccccc2)N1C1CCCCC1.
What is the InChIKey of 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one?
The InChIKey is BDDPHDDROFKLDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21NO/c19-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15/h1,3-4,8-9,12,15H,2,5-7,10-11,13H2.
What are the key properties of 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one?
1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one has a molecular weight of 255.36 g/mol, XLogP of 3.98, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-6-phenyl-3,4-dihydropyridin-2-one is sourced from PubChem (CID 10777410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).