About (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid
(2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid (PubChem CID 107774315) has the molecular formula C15H19NO4S
and a molecular weight of 309.39 g/mol. Its IUPAC name is (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid |
| PubChem CID | 107774315 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid |
| SMILES | CC(=O)N[C@@H](CSCC1CCOc2ccccc21)C(=O)O |
| InChI | InChI=1S/C15H19NO4S/c1-10(17)16-13(15(18)19)9-21-8-11-6-7-20-14-5-3-2-4-12(11)14/h2-5,11,13H,6-9H2,1H3,(H,16,17)(H,18,19)/t11?,13-/m0/s1 |
| InChIKey | KUUZQPPMXBTCMO-YUZLPWPTSA-N |
| XLogP | 1.88 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid?
The IUPAC name of (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid (CID 107774315) is (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid.
What is the SMILES notation for (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid?
The canonical SMILES for (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid is CC(=O)N[C@@H](CSCC1CCOc2ccccc21)C(=O)O.
What is the InChIKey of (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid?
The InChIKey is KUUZQPPMXBTCMO-YUZLPWPTSA-N. The full InChI is InChI=1S/C15H19NO4S/c1-10(17)16-13(15(18)19)9-21-8-11-6-7-20-14-5-3-2-4-12(11)14/h2-5,11,13H,6-9H2,1H3,(H,16,17)(H,18,19)/t11?,13-/m0/s1.
What are the key properties of (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid?
(2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid has a molecular weight of 309.39 g/mol, XLogP of 1.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-acetamido-3-(3,4-dihydro-2H-chromen-4-ylmethylsulfanyl)propanoic acid is sourced from PubChem (CID 107774315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).