C14H22N2O4S — CID 107774673
(2R)-2-acetamido-3-[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl]sulfanylpropanoic acid (PubChem CID 107774673) has the molecular formula C14H22N2O4S and a molecular weight of 314.41 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107774673 |
| Molecular Formula | C14H22N2O4S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (2R)-2-acetamido-3-[2-[cyclopenten-1-yl(ethyl)amino]-2-oxoethyl]sulfanylpropanoic acid |
| SMILES | CCN(C(=O)CSC[C@H](NC(C)=O)C(=O)O)C1=CCCC1 |
| InChI | InChI=1S/C14H22N2O4S/c1-3-16(11-6-4-5-7-11)13(18)9-21-8-12(14(19)20)15-10(2)17/h6,12H,3-5,7-9H2,1-2H3,(H,15,17)(H,19,20)/t12-/m0/s1 |
| InChIKey | KUDWLGSIDDAYGC-LBPRGKRZSA-N |
| XLogP | 1.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |