C16H18O3 — CID 10777597
(1'R,2R,2'R,6'S,7'R)-7'-methoxy-3'-propan-2-ylidenespiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one (PubChem CID 10777597) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (1'R,2R,2'R,6'S,7'R)-7'-methoxy-3'-propan-2-ylidenespiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one.
| Compound Name | (1'R,2R,2'R,6'S,7'R)-7'-methoxy-3'-propan-2-ylidenespiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
|---|---|
| PubChem CID | 10777597 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (1'R,2R,2'R,6'S,7'R)-7'-methoxy-3'-propan-2-ylidenespiro[oxirane-2,9'-tricyclo[5.2.2.02,6]undeca-4,10-diene]-8'-one |
| SMILES | CO[C@]12C=C[C@H]([C@@H]3C(=C(C)C)C=C[C@@H]31)[C@@]1(CO1)C2=O |
| InChI | InChI=1S/C16H18O3/c1-9(2)10-4-5-11-13(10)12-6-7-15(11,18-3)14(17)16(12)8-19-16/h4-7,11-13H,8H2,1-3H3/t11-,12+,13+,15+,16-/m0/s1 |
| InChIKey | UAVOQUUJTDVQGD-HGYYMRRCSA-N |
| XLogP | 2.05 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|