C15H17F3O2S — CID 107775979
methyl 2-[1-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]cyclopropyl]acetate (PubChem CID 107775979) has the molecular formula C15H17F3O2S and a molecular weight of 318.36 g/mol. Its IUPAC name is methyl 2-[1-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107775979 |
| Molecular Formula | C15H17F3O2S |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | methyl 2-[1-[[3-(trifluoromethyl)phenyl]methylsulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H17F3O2S/c1-20-13(19)8-14(5-6-14)10-21-9-11-3-2-4-12(7-11)15(16,17)18/h2-4,7H,5-6,8-10H2,1H3 |
| InChIKey | VWSVSDDJJQXTDB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |