C13H17NO2S — CID 107776090
methyl 2-[1-(pyridin-3-ylmethylsulfanylmethyl)cyclopropyl]acetate (PubChem CID 107776090) has the molecular formula C13H17NO2S and a molecular weight of 251.35 g/mol. Its IUPAC name is methyl 2-[1-(pyridin-3-ylmethylsulfanylmethyl)cyclopropyl]acetate.
| Compound Name | methyl 2-[1-(pyridin-3-ylmethylsulfanylmethyl)cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776090 |
| Molecular Formula | C13H17NO2S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.10 |
| IUPAC Name | methyl 2-[1-(pyridin-3-ylmethylsulfanylmethyl)cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSCc2cccnc2)CC1 |
| InChI | InChI=1S/C13H17NO2S/c1-16-12(15)7-13(4-5-13)10-17-9-11-3-2-6-14-8-11/h2-3,6,8H,4-5,7,9-10H2,1H3 |
| InChIKey | JPPHZWXFBXMESW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |