About methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate
methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776547) has the molecular formula C10H18N2O5S
and a molecular weight of 278.33 g/mol. Its IUPAC name is methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate |
| PubChem CID | 107776547 |
| Molecular Formula | C10H18N2O5S |
| Molecular Weight | 278.33 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)CC(N)C(N)=O)CC1 |
| InChI | InChI=1S/C10H18N2O5S/c1-17-8(13)4-10(2-3-10)6-18(15,16)5-7(11)9(12)14/h7H,2-6,11H2,1H3,(H2,12,14) |
| InChIKey | AFVYXHACUAAXEP-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 129.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.33 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate?
The IUPAC name of methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate (CID 107776547) is methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate.
What is the SMILES notation for methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate?
The canonical SMILES for methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate is COC(=O)CC1(CS(=O)(=O)CC(N)C(N)=O)CC1.
What is the InChIKey of methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate?
The InChIKey is AFVYXHACUAAXEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O5S/c1-17-8(13)4-10(2-3-10)6-18(15,16)5-7(11)9(12)14/h7H,2-6,11H2,1H3,(H2,12,14).
What are the key properties of methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate?
methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate has a molecular weight of 278.33 g/mol, XLogP of -1.44, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(2,3-diamino-3-oxopropyl)sulfonylmethyl]cyclopropyl]acetate is sourced from PubChem (CID 107776547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).