About methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate
methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate (PubChem CID 107776619) has the molecular formula C11H18O6S2
and a molecular weight of 310.39 g/mol. Its IUPAC name is methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate |
| PubChem CID | 107776619 |
| Molecular Formula | C11H18O6S2 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)C2CCS(=O)(=O)C2)CC1 |
| InChI | InChI=1S/C11H18O6S2/c1-17-10(12)6-11(3-4-11)8-19(15,16)9-2-5-18(13,14)7-9/h9H,2-8H2,1H3 |
| InChIKey | YZAVBAUTQZQLCS-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 94.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate?
The IUPAC name of methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate (CID 107776619) is methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate.
What is the SMILES notation for methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate?
The canonical SMILES for methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate is COC(=O)CC1(CS(=O)(=O)C2CCS(=O)(=O)C2)CC1.
What is the InChIKey of methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate?
The InChIKey is YZAVBAUTQZQLCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6S2/c1-17-10(12)6-11(3-4-11)8-19(15,16)9-2-5-18(13,14)7-9/h9H,2-8H2,1H3.
What are the key properties of methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate?
methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate has a molecular weight of 310.39 g/mol, XLogP of -0.07, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(1,1-dioxothiolan-3-yl)sulfonylmethyl]cyclopropyl]acetate is sourced from PubChem (CID 107776619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).