About methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate
methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate (PubChem CID 107776697) has the molecular formula C9H14F2O4S
and a molecular weight of 256.27 g/mol. Its IUPAC name is methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate |
| PubChem CID | 107776697 |
| Molecular Formula | C9H14F2O4S |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CS(=O)(=O)CC(F)F)CC1 |
| InChI | InChI=1S/C9H14F2O4S/c1-15-8(12)4-9(2-3-9)6-16(13,14)5-7(10)11/h7H,2-6H2,1H3 |
| InChIKey | NICUKSUNRIXPDF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate?
The IUPAC name of methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate (CID 107776697) is methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate.
What is the SMILES notation for methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate?
The canonical SMILES for methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate is COC(=O)CC1(CS(=O)(=O)CC(F)F)CC1.
What is the InChIKey of methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate?
The InChIKey is NICUKSUNRIXPDF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F2O4S/c1-15-8(12)4-9(2-3-9)6-16(13,14)5-7(10)11/h7H,2-6H2,1H3.
What are the key properties of methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate?
methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate has a molecular weight of 256.27 g/mol, XLogP of 1.01, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-(2,2-difluoroethylsulfonylmethyl)cyclopropyl]acetate is sourced from PubChem (CID 107776697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).