C14H20N2O3S — CID 107776855
methyl 2-[1-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107776855) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 2-[1-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate.
| Compound Name | methyl 2-[1-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate |
|---|---|
| PubChem CID | 107776855 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 2-[1-[(6-oxo-2-propan-2-yl-1H-pyrimidin-4-yl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSc2cc(=O)[nH]c(C(C)C)n2)CC1 |
| InChI | InChI=1S/C14H20N2O3S/c1-9(2)13-15-10(17)6-11(16-13)20-8-14(4-5-14)7-12(18)19-3/h6,9H,4-5,7-8H2,1-3H3,(H,15,16,17) |
| InChIKey | GEVQOYDMJSJEAE-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |