C13H15NO4S — CID 107777153
6-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]pyridine-3-carboxylic acid (PubChem CID 107777153) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is 6-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]pyridine-3-carboxylic acid.
| Compound Name | 6-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 107777153 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 6-[[1-(2-methoxy-2-oxoethyl)cyclopropyl]methylsulfanyl]pyridine-3-carboxylic acid |
| SMILES | COC(=O)CC1(CSc2ccc(C(=O)O)cn2)CC1 |
| InChI | InChI=1S/C13H15NO4S/c1-18-11(15)6-13(4-5-13)8-19-10-3-2-9(7-14-10)12(16)17/h2-3,7H,4-6,8H2,1H3,(H,16,17) |
| InChIKey | DVSFXLJFDKZSDE-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 76.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |