About methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate
methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate (PubChem CID 107777383) has the molecular formula C11H18F3NO2S
and a molecular weight of 285.33 g/mol. Its IUPAC name is methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate.
Molecular Properties
| Compound Name | methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate |
| PubChem CID | 107777383 |
| Molecular Formula | C11H18F3NO2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate |
| SMILES | COC(=O)CC1(CSC(C(C)N)C(F)(F)F)CC1 |
| InChI | InChI=1S/C11H18F3NO2S/c1-7(15)9(11(12,13)14)18-6-10(3-4-10)5-8(16)17-2/h7,9H,3-6,15H2,1-2H3 |
| InChIKey | VBFGKGBLSOJADJ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate?
The IUPAC name of methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate (CID 107777383) is methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate.
What is the SMILES notation for methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate?
The canonical SMILES for methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate is COC(=O)CC1(CSC(C(C)N)C(F)(F)F)CC1.
What is the InChIKey of methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate?
The InChIKey is VBFGKGBLSOJADJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO2S/c1-7(15)9(11(12,13)14)18-6-10(3-4-10)5-8(16)17-2/h7,9H,3-6,15H2,1-2H3.
What are the key properties of methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate?
methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate has a molecular weight of 285.33 g/mol, XLogP of 2.34, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[1-[(3-amino-1,1,1-trifluorobutan-2-yl)sulfanylmethyl]cyclopropyl]acetate is sourced from PubChem (CID 107777383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).