About (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one
(3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one (PubChem CID 10777944) has the molecular formula C14H17NO4
and a molecular weight of 263.29 g/mol. Its IUPAC name is (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one.
Molecular Properties
| Compound Name | (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one |
| PubChem CID | 10777944 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one |
| SMILES | C=CCN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@H](O)CO |
| InChI | InChI=1S/C14H17NO4/c1-2-8-15-12(11(17)9-16)13(14(15)18)19-10-6-4-3-5-7-10/h2-7,11-13,16-17H,1,8-9H2/t11-,12+,13-/m1/s1 |
| InChIKey | OPYKMCVHCMLKPI-FRRDWIJNSA-N |
| XLogP | 0.18 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one?
The IUPAC name of (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one (CID 10777944) is (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one.
What is the SMILES notation for (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one?
The canonical SMILES for (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one is C=CCN1C(=O)[C@H](Oc2ccccc2)[C@@H]1[C@H](O)CO.
What is the InChIKey of (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one?
The InChIKey is OPYKMCVHCMLKPI-FRRDWIJNSA-N. The full InChI is InChI=1S/C14H17NO4/c1-2-8-15-12(11(17)9-16)13(14(15)18)19-10-6-4-3-5-7-10/h2-7,11-13,16-17H,1,8-9H2/t11-,12+,13-/m1/s1.
What are the key properties of (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one?
(3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one has a molecular weight of 263.29 g/mol, XLogP of 0.18, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-4-[(1S)-1,2-dihydroxyethyl]-3-phenoxy-1-prop-2-enylazetidin-2-one is sourced from PubChem (CID 10777944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).