About N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline
N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline (PubChem CID 10778030) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline.
Molecular Properties
| Compound Name | N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline |
| PubChem CID | 10778030 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline |
| SMILES | C(\C1=NCCO1)=C(\Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16N2O/c1-3-7-14(8-4-1)16(13-17-18-11-12-20-17)19-15-9-5-2-6-10-15/h1-10,13,19H,11-12H2/b16-13- |
| InChIKey | WMZQCEUGZROVOI-SSZFMOIBSA-N |
| XLogP | 3.57 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline?
The IUPAC name of N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline (CID 10778030) is N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline.
What is the SMILES notation for N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline?
The canonical SMILES for N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline is C(\C1=NCCO1)=C(\Nc1ccccc1)c1ccccc1.
What is the InChIKey of N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline?
The InChIKey is WMZQCEUGZROVOI-SSZFMOIBSA-N. The full InChI is InChI=1S/C17H16N2O/c1-3-7-14(8-4-1)16(13-17-18-11-12-20-17)19-15-9-5-2-6-10-15/h1-10,13,19H,11-12H2/b16-13-.
What are the key properties of N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline?
N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline has a molecular weight of 264.33 g/mol, XLogP of 3.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-2-(4,5-dihydro-1,3-oxazol-2-yl)-1-phenylethenyl]aniline is sourced from PubChem (CID 10778030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).