About [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine
[4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine (PubChem CID 107781025) has the molecular formula C13H16N2OS
and a molecular weight of 248.35 g/mol. Its IUPAC name is [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine.
Molecular Properties
| Compound Name | [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine |
| PubChem CID | 107781025 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine |
| SMILES | Cc1cc(C)c(CN)c(Sc2ccoc2C)n1 |
| InChI | InChI=1S/C13H16N2OS/c1-8-6-9(2)15-13(11(8)7-14)17-12-4-5-16-10(12)3/h4-6H,7,14H2,1-3H3 |
| InChIKey | XGUTZVAZPNPMGK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine?
The IUPAC name of [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine (CID 107781025) is [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine.
What is the SMILES notation for [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine?
The canonical SMILES for [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine is Cc1cc(C)c(CN)c(Sc2ccoc2C)n1.
What is the InChIKey of [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine?
The InChIKey is XGUTZVAZPNPMGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2OS/c1-8-6-9(2)15-13(11(8)7-14)17-12-4-5-16-10(12)3/h4-6H,7,14H2,1-3H3.
What are the key properties of [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine?
[4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine has a molecular weight of 248.35 g/mol, XLogP of 3.21, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4,6-dimethyl-2-(2-methylfuran-3-yl)sulfanyl-3-pyridinyl]methanamine is sourced from PubChem (CID 107781025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).