C14H21NO3S — CID 107782153
methyl 2-(cyclopropylamino)-2-methyl-4-(2-methylfuran-3-yl)sulfanylbutanoate (PubChem CID 107782153) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is methyl 2-(cyclopropylamino)-2-methyl-4-(2-methylfuran-3-yl)sulfanylbutanoate.
| Compound Name | methyl 2-(cyclopropylamino)-2-methyl-4-(2-methylfuran-3-yl)sulfanylbutanoate |
|---|---|
| PubChem CID | 107782153 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | methyl 2-(cyclopropylamino)-2-methyl-4-(2-methylfuran-3-yl)sulfanylbutanoate |
| SMILES | COC(=O)C(C)(CCSc1ccoc1C)NC1CC1 |
| InChI | InChI=1S/C14H21NO3S/c1-10-12(6-8-18-10)19-9-7-14(2,13(16)17-3)15-11-4-5-11/h6,8,11,15H,4-5,7,9H2,1-3H3 |
| InChIKey | IVFQOHKDOJQPHH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |