C14H23NO3S — CID 107782178
2-methyl-4-(2-methylfuran-3-yl)sulfanyl-2-(propylamino)pentanoic acid (PubChem CID 107782178) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is 2-methyl-4-(2-methylfuran-3-yl)sulfanyl-2-(propylamino)pentanoic acid.
| Compound Name | 2-methyl-4-(2-methylfuran-3-yl)sulfanyl-2-(propylamino)pentanoic acid |
|---|---|
| PubChem CID | 107782178 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 2-methyl-4-(2-methylfuran-3-yl)sulfanyl-2-(propylamino)pentanoic acid |
| SMILES | CCCNC(C)(CC(C)Sc1ccoc1C)C(=O)O |
| InChI | InChI=1S/C14H23NO3S/c1-5-7-15-14(4,13(16)17)9-10(2)19-12-6-8-18-11(12)3/h6,8,10,15H,5,7,9H2,1-4H3,(H,16,17) |
| InChIKey | SCKVVVQQBVRZBE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |