C7H9N7O2S2 — CID 107782404
3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107782404) has the molecular formula C7H9N7O2S2 and a molecular weight of 287.33 g/mol. Its IUPAC name is 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107782404 |
| Molecular Formula | C7H9N7O2S2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-[(5-hydrazinyl-1,3,4-thiadiazol-2-yl)methylsulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCc1nnc(NN)s1 |
| InChI | InChI=1S/C7H9N7O2S2/c1-14-7(9-4(15)5(16)13-14)17-2-3-11-12-6(10-8)18-3/h2,8H2,1H3,(H,10,12)(H,13,16) |
| InChIKey | SMKDVNCLTMLECC-UHFFFAOYSA-N |
| XLogP | -1.10 |
| TPSA | 131.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|