C12H23N3S — CID 107782493
N-[2-(1H-imidazol-2-ylsulfanyl)ethyl]-5-methylhexan-2-amine (PubChem CID 107782493) has the molecular formula C12H23N3S and a molecular weight of 241.40 g/mol. Its IUPAC name is N-[2-(1H-imidazol-2-ylsulfanyl)ethyl]-5-methylhexan-2-amine.
| Compound Name | N-[2-(1H-imidazol-2-ylsulfanyl)ethyl]-5-methylhexan-2-amine |
|---|---|
| PubChem CID | 107782493 |
| Molecular Formula | C12H23N3S |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N-[2-(1H-imidazol-2-ylsulfanyl)ethyl]-5-methylhexan-2-amine |
| SMILES | CC(C)CCC(C)NCCSc1ncc[nH]1 |
| InChI | InChI=1S/C12H23N3S/c1-10(2)4-5-11(3)13-8-9-16-12-14-6-7-15-12/h6-7,10-11,13H,4-5,8-9H2,1-3H3,(H,14,15) |
| InChIKey | SWFHOUIOARBYRT-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|