C11H19NO2S — CID 107782588
N-(2-methoxyethyl)-3-(2-methylfuran-3-yl)sulfanylpropan-1-amine (PubChem CID 107782588) has the molecular formula C11H19NO2S and a molecular weight of 229.34 g/mol. Its IUPAC name is N-(2-methoxyethyl)-3-(2-methylfuran-3-yl)sulfanylpropan-1-amine.
| Compound Name | N-(2-methoxyethyl)-3-(2-methylfuran-3-yl)sulfanylpropan-1-amine |
|---|---|
| PubChem CID | 107782588 |
| Molecular Formula | C11H19NO2S |
| Molecular Weight | 229.34 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | N-(2-methoxyethyl)-3-(2-methylfuran-3-yl)sulfanylpropan-1-amine |
| SMILES | COCCNCCCSc1ccoc1C |
| InChI | InChI=1S/C11H19NO2S/c1-10-11(4-7-14-10)15-9-3-5-12-6-8-13-2/h4,7,12H,3,5-6,8-9H2,1-2H3 |
| InChIKey | MJAJXGUFGRZQQB-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|