C6H9N5O3S — CID 107782915
2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]acetohydrazide (PubChem CID 107782915) has the molecular formula C6H9N5O3S and a molecular weight of 231.24 g/mol. Its IUPAC name is 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]acetohydrazide.
| Compound Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]acetohydrazide |
|---|---|
| PubChem CID | 107782915 |
| Molecular Formula | C6H9N5O3S |
| Molecular Weight | 231.24 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]acetohydrazide |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SCC(=O)NN |
| InChI | InChI=1S/C6H9N5O3S/c1-11-6(15-2-3(12)9-7)8-4(13)5(14)10-11/h2,7H2,1H3,(H,9,12)(H,10,14) |
| InChIKey | YOIPXWXBQHHWFN-UHFFFAOYSA-N |
| XLogP | -2.45 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.24 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|