C8H13N5O3S — CID 107782934
2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanehydrazide (PubChem CID 107782934) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanehydrazide.
| Compound Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanehydrazide |
|---|---|
| PubChem CID | 107782934 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 2-[(2-methyl-5,6-dioxo-1H-1,2,4-triazin-3-yl)sulfanyl]butanehydrazide |
| SMILES | CCC(Sc1nc(=O)c(=O)[nH]n1C)C(=O)NN |
| InChI | InChI=1S/C8H13N5O3S/c1-3-4(5(14)11-9)17-8-10-6(15)7(16)12-13(8)2/h4H,3,9H2,1-2H3,(H,11,14)(H,12,16) |
| InChIKey | ZOVMZXVDRUKDMK-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 122.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|