C15H12N2OS — CID 10778313
13-methoxy-8-thia-6,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,11(16),12,14-heptaene (PubChem CID 10778313) has the molecular formula C15H12N2OS and a molecular weight of 268.34 g/mol. Its IUPAC name is 13-methoxy-8-thia-6,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,11(16),12,14-heptaene.
| Compound Name | 13-methoxy-8-thia-6,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 10778313 |
| Molecular Formula | C15H12N2OS |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.07 |
| IUPAC Name | 13-methoxy-8-thia-6,17-diazatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2(7),3,5,11(16),12,14-heptaene |
| SMILES | COc1ccc2[nH]c3c(c2c1)CSc1ncccc1-3 |
| InChI | InChI=1S/C15H12N2OS/c1-18-9-4-5-13-11(7-9)12-8-19-15-10(14(12)17-13)3-2-6-16-15/h2-7,17H,8H2,1H3 |
| InChIKey | HISJAQAJMHGDOW-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |