C11H11FN2OS — CID 107783375
1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)phenyl]ethanol (PubChem CID 107783375) has the molecular formula C11H11FN2OS and a molecular weight of 238.29 g/mol. Its IUPAC name is 1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)phenyl]ethanol.
| Compound Name | 1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)phenyl]ethanol |
|---|---|
| PubChem CID | 107783375 |
| Molecular Formula | C11H11FN2OS |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | 1-[5-fluoro-2-(1H-imidazol-2-ylsulfanyl)phenyl]ethanol |
| SMILES | CC(O)c1cc(F)ccc1Sc1ncc[nH]1 |
| InChI | InChI=1S/C11H11FN2OS/c1-7(15)9-6-8(12)2-3-10(9)16-11-13-4-5-14-11/h2-7,15H,1H3,(H,13,14) |
| InChIKey | RIWPPONEJQZFND-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |