C14H19N3S — CID 107783907
2-(1H-imidazol-2-ylsulfanyl)-N-methyl-1-(4-methylphenyl)propan-1-amine (PubChem CID 107783907) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is 2-(1H-imidazol-2-ylsulfanyl)-N-methyl-1-(4-methylphenyl)propan-1-amine.
| Compound Name | 2-(1H-imidazol-2-ylsulfanyl)-N-methyl-1-(4-methylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 107783907 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-(1H-imidazol-2-ylsulfanyl)-N-methyl-1-(4-methylphenyl)propan-1-amine |
| SMILES | CNC(c1ccc(C)cc1)C(C)Sc1ncc[nH]1 |
| InChI | InChI=1S/C14H19N3S/c1-10-4-6-12(7-5-10)13(15-3)11(2)18-14-16-8-9-17-14/h4-9,11,13,15H,1-3H3,(H,16,17) |
| InChIKey | XRLXHWNZBVAZBI-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |