C12H22N4O2S — CID 107784414
2-methyl-3-[4-(propylamino)pentan-2-ylsulfanyl]-1H-1,2,4-triazine-5,6-dione (PubChem CID 107784414) has the molecular formula C12H22N4O2S and a molecular weight of 286.40 g/mol. Its IUPAC name is 2-methyl-3-[4-(propylamino)pentan-2-ylsulfanyl]-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 2-methyl-3-[4-(propylamino)pentan-2-ylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107784414 |
| Molecular Formula | C12H22N4O2S |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-methyl-3-[4-(propylamino)pentan-2-ylsulfanyl]-1H-1,2,4-triazine-5,6-dione |
| SMILES | CCCNC(C)CC(C)Sc1nc(=O)c(=O)[nH]n1C |
| InChI | InChI=1S/C12H22N4O2S/c1-5-6-13-8(2)7-9(3)19-12-14-10(17)11(18)15-16(12)4/h8-9,13H,5-7H2,1-4H3,(H,15,18) |
| InChIKey | KNLWMXMIRNXYEI-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|