C13H14N4O3S — CID 107784431
3-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione (PubChem CID 107784431) has the molecular formula C13H14N4O3S and a molecular weight of 306.35 g/mol. Its IUPAC name is 3-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione.
| Compound Name | 3-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
|---|---|
| PubChem CID | 107784431 |
| Molecular Formula | C13H14N4O3S |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.08 |
| IUPAC Name | 3-[(4-amino-3,4-dihydro-2H-chromen-3-yl)sulfanyl]-2-methyl-1H-1,2,4-triazine-5,6-dione |
| SMILES | Cn1[nH]c(=O)c(=O)nc1SC1COc2ccccc2C1N |
| InChI | InChI=1S/C13H14N4O3S/c1-17-13(15-11(18)12(19)16-17)21-9-6-20-8-5-3-2-4-7(8)10(9)14/h2-5,9-10H,6,14H2,1H3,(H,16,19) |
| InChIKey | WHWGPTSTBIDHQE-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 103.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|